CAS 312736-50-8 appears in our catalog under these names: 3,5-Dichloropyrazine-2-carboxamide 98%, 3,5-Dichloropyrazine-2-carboxamide, 98%, 98%, 3,5-Dichloropyrazine-2-carboxamide, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g, 10g.
3,5-dichloropyrazine-2-carboxamide (CAS 312736-50-8) is a chemical compound with the molecular formula C5H3Cl2N3O and a molecular weight of 192.00 g/mol. IUPAC name: 3,5-dichloropyrazine-2-carboxamide. InChIKey: UFKLYKVKEHHZRT-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 3,5-dichloropyrazine-2-carboxamide |
| InChIKey | UFKLYKVKEHHZRT-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)C(=O)N)Cl)Cl |
Computed by PubChem (NCBI)