cas: 287944-16-5 — see every product listed under this CAS number, including other names
3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester, 98%, 98% (CAS 287944-16-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148OX-250mg |
| cas | 287944-16-5 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 347.60 Pln | |
| Chemat | 50g | 635.60 Pln | |
| Chemat | 100g | 1202.00 Pln | |
| Chemat | 250g | 2834.00 Pln | |
| Chemat | 500g | 5505.60 Pln | |
| Chemat | 1kg | 6448.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3,6-dihydro-2H-pyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 287944-16-5) is a chemical compound with the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. IUPAC name: 2-(3,6-dihydro-2H-pyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DOSGEBYQRMBTGS-UHFFFAOYSA-N.
| Molecular formula | C11H19BO3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 2-(3,6-dihydro-2H-pyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DOSGEBYQRMBTGS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCOCC2 |
Computed by PubChem (NCBI)