CAS 1025707-93-0 appears in our catalog under these names: 3,4-Dihydro-2H-pyran-6-boronic acid pinacol ester, 95%, 2–(3,4–Dihydro–2H–pyran–6–yl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 3,4-Dihydro-2H-pyran-6-boronic acid pinacol ester 95% (stabilized with 1%BHT), 3,4-DIHYDRO-2H-PYRAN-6-BORONIC ACID PIN&, 3,4-Dihydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyran, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 10g, 100mg, 50g.
2-(3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1025707-93-0) is a chemical compound with the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. IUPAC name: 2-(3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RNRIMDSCBRDPLC-UHFFFAOYSA-N.
| Molecular formula | C11H19BO3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 2-(3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RNRIMDSCBRDPLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCO2 |
Computed by PubChem (NCBI)