Products 3786-46-7
CAS 3786-46-7 appears in our catalog under these names: 3,6-Dihydroxyphthalic acid 97%, 3，6-Dihydroxyphthalic acid, 97%, 97%, 3,6-Dihydroxyphthalic acid, ≥97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,6-dihydroxyphthalic acid (CAS 3786-46-7) is a chemical compound with the molecular formula C8H6O6 and a molecular weight of 198.13 g/mol. IUPAC name: 3,6-dihydroxyphthalic acid. InChIKey: UDKMUSGWGWZJBZ-UHFFFAOYSA-N.
| Molecular formula | C8H6O6 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 3,6-dihydroxyphthalic acid |
| InChIKey | UDKMUSGWGWZJBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)C(=O)O)C(=O)O)O |
Computed by PubChem (NCBI)