Products 19829-72-2
CAS 19829-72-2 appears in our catalog under these names: 2,3–Dihydroxyterephthalic acid, 2,3-Dihydroxyterephthalic acid, 95%, 2,3-Dihydroxyterephthalic acid, 97%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 50g, 250mg, 500g.
2,3-dihydroxyterephthalic acid (CAS 19829-72-2) is a chemical compound with the molecular formula C8H6O6 and a molecular weight of 198.13 g/mol. IUPAC name: 2,3-dihydroxyterephthalic acid. InChIKey: OHLSHRJUBRUKAN-UHFFFAOYSA-N.
| Molecular formula | C8H6O6 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 2,3-dihydroxyterephthalic acid |
| InChIKey | OHLSHRJUBRUKAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)O)O)C(=O)O |
Computed by PubChem (NCBI)