cas: 54660-00-3 — see every product listed under this CAS number, including other names
3,6-Diphenylpyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione 98% (CAS 54660-00-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A369089-1g |
| cas | 54660-00-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 476.06 Pln | |
| Ambeed | 25g | 1405.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A369089 |
3-hydroxy-1,4-diphenyl-2H-pyrrolo[3,4-c]pyrrol-6-one (CAS 54660-00-3) is a chemical compound with the molecular formula C18H12N2O2 and a molecular weight of 288.3 g/mol. IUPAC name: 3-hydroxy-1,4-diphenyl-2H-pyrrolo[3,4-c]pyrrol-6-one. InChIKey: KKLJFKIBTOBVJI-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 3-hydroxy-1,4-diphenyl-2H-pyrrolo[3,4-c]pyrrol-6-one |
| InChIKey | KKLJFKIBTOBVJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C(=C(N2)O)C(=NC3=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)