Products 25287-05-2
CAS 25287-05-2 appears in our catalog under these names: 2-(4-Amino-phenyl)-benzo[de]isoquinoline-1,3-dione, 95%, 2-(4-Aminophenyl)-1H-benzo(de)isoquinoline-1,3(2H)-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(4-aminophenyl)benzo[de]isoquinoline-1,3-dione (CAS 25287-05-2) is a chemical compound with the molecular formula C18H12N2O2 and a molecular weight of 288.3 g/mol. IUPAC name: 2-(4-aminophenyl)benzo[de]isoquinoline-1,3-dione. InChIKey: ZMJZCOQYUBLDCT-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 2-(4-aminophenyl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | ZMJZCOQYUBLDCT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)