Products 79580-35-1
CAS 79580-35-1 appears in our catalog under these names: 3,8-Dibromobenzo[c]cinnoline, 98%, 98%, 3,8-Dibromobenzo[c]cinnoline, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,8-dibromobenzo[c]cinnoline (CAS 79580-35-1) is a chemical compound with the molecular formula C12H6Br2N2 and a molecular weight of 338.00 g/mol. IUPAC name: 3,8-dibromobenzo[c]cinnoline. InChIKey: DHEJMXHUNWPNME-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2 |
|---|---|
| Molecular weight | 338.00 g/mol |
| IUPAC name | 3,8-dibromobenzo[c]cinnoline |
| InChIKey | DHEJMXHUNWPNME-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C=CC(=CC3=NN=C2C=C1Br)Br |
Computed by PubChem (NCBI)