3,9'-Bi-9H-carbazole, 97%, 97%
cas: 18628-07-4 — see every product listed under this CAS number, including other names
3,9'-Bi-9H-carbazole, 97%, 97% (CAS 18628-07-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 250g, 500g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148WN-10g |
| cas | 18628-07-4 |
| size | 10g |
| availability | 5000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 232.40 Pln | |
| Chemat | 50g | 875.60 Pln | |
| Chemat | 250g | 3506.00 Pln | |
| Chemat | 500g | 5289.60 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 100g | 1629.20 Pln | |
| Chemat | 1kg | 7557.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-carbazol-9-yl-9H-carbazole (CAS 18628-07-4) is a chemical compound with the molecular formula C24H16N2 and a molecular weight of 332.4 g/mol. IUPAC name: 3-carbazol-9-yl-9H-carbazole. InChIKey: FHJJVSJWFYYPAC-UHFFFAOYSA-N.
| Molecular formula | C24H16N2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 3-carbazol-9-yl-9H-carbazole |
| InChIKey | FHJJVSJWFYYPAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)N4C5=CC=CC=C5C6=CC=CC=C64 |
Computed by PubChem (NCBI)