CAS 79026-03-2 appears in our catalog under these names: Fluorescent brightener er-iii, 95%, Fluorescent Brightener ER-III, Fluorescent Brightener ER–III, Fluorescent Brightener ER-III, 97% (HPLC), 97% (HPLC), Fluorescent Brightener ER-III, 97% (HPLC). Offered by: Combi-blocks, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 10mg, 25mg, 50mg, Get quote.
2-[(E)-2-[4-[(E)-2-(3-cyanophenyl)ethenyl]phenyl]ethenyl]benzonitrile (CAS 79026-03-2) is a chemical compound with the molecular formula C24H16N2 and a molecular weight of 332.4 g/mol. IUPAC name: 2-[(E)-2-[4-[(E)-2-(3-cyanophenyl)ethenyl]phenyl]ethenyl]benzonitrile. InChIKey: JRVKAPLKKVWGKU-SQIWNDBBSA-N.
| Molecular formula | C24H16N2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2-[(E)-2-[4-[(E)-2-(3-cyanophenyl)ethenyl]phenyl]ethenyl]benzonitrile |
| InChIKey | JRVKAPLKKVWGKU-SQIWNDBBSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C2=CC=C(C=C2)/C=C/C3=CC(=CC=C3)C#N)C#N |
Computed by PubChem (NCBI)