3,9-Bis(2,4-di-tert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane, 98%, 98%
cas: 26741-53-7 — see every product listed under this CAS number, including other names
3,9-Bis(2,4-di-tert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane, 98%, 98% (CAS 26741-53-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 200g, 300g, 500g, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILNB-5g |
| cas | 26741-53-7 |
| size | 5g |
| availability | 10000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 69.20 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 93.20 Pln | |
| Chemat | 100g | 107.60 Pln | |
| Chemat | 200g | 150.80 Pln | |
| Chemat | 300g | 194.00 Pln | |
| Chemat | 500g | 297.60 Pln | |
| Chemat | 5kg | 2630.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,9-bis(2,4-ditert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (CAS 26741-53-7) is a chemical compound with the molecular formula C33H50O6P2 and a molecular weight of 604.7 g/mol. IUPAC name: 3,9-bis(2,4-ditert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane. InChIKey: AIBRSVLEQRWAEG-UHFFFAOYSA-N.
| Molecular formula | C33H50O6P2 |
|---|---|
| Molecular weight | 604.7 g/mol |
| IUPAC name | 3,9-bis(2,4-ditert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| InChIKey | AIBRSVLEQRWAEG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OP2OCC3(CO2)COP(OC3)OC4=C(C=C(C=C4)C(C)(C)C)C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Antioxidant 626, ADK Stab PEP 24, Antioxidant 242, Bis(2,4-di-tert-butylphenyl)pentaerythritol diphosphite, Alkanox P 24, Doverphos S 9432, ADK Stab PEP 24G, Bis(2,4-di-tert-butylphenyl) pentaerythritol diphosphite, Phosphorous acid, cyclic neopentanetetrayl bis(2,4-di-tert-butylphenyl) ester, di(2,4-di-tert-butylphenyl)pentaerythritol diphosphite