CAS 26741-53-7 appears in our catalog under these names: Antioxidant 24, 97%, Antioxidant 24, >95% (HPLC), 3,9-Bis(2,4-di-tert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane, >95.0%(GC), AntiOxidant 24, Antioxidant 24 97% GC. Offered by: Combi-blocks, TRC, TCI, Biosynth, Ambeed. Available pack sizes: 100g, 500g, 25g, 5g, 10g, 250g, 50g, 1000g.
3,9-bis(2,4-ditert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (CAS 26741-53-7) is a chemical compound with the molecular formula C33H50O6P2 and a molecular weight of 604.7 g/mol. IUPAC name: 3,9-bis(2,4-ditert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane. InChIKey: AIBRSVLEQRWAEG-UHFFFAOYSA-N.
| Molecular formula | C33H50O6P2 |
|---|---|
| Molecular weight | 604.7 g/mol |
| IUPAC name | 3,9-bis(2,4-ditert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| InChIKey | AIBRSVLEQRWAEG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OP2OCC3(CO2)COP(OC3)OC4=C(C=C(C=C4)C(C)(C)C)C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)