3–Fluoro–5–(trifluoromethyl)phenol
cas: 172333-87-8 — see every product listed under this CAS number, including other names
3–Fluoro–5–(trifluoromethyl)phenol (CAS 172333-87-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 2g, 50g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD13083-10g |
| cas | 172333-87-8 |
| size | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1416.13 Pln | |
| GLPBio | 1g | 592.36 Pln | |
| GLPBio | 25g | 1945.02 Pln | |
| GLPBio | 2g | 700.01 Pln | |
| GLPBio | 50g | 3222.80 Pln | |
| GLPBio | 5g | 994.88 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-fluoro-5-(trifluoromethyl)phenol (CAS 172333-87-8) is a chemical compound with the molecular formula C7H4F4O and a molecular weight of 180.10 g/mol. IUPAC name: 3-fluoro-5-(trifluoromethyl)phenol. InChIKey: VNTKPYNBATZMSV-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 3-fluoro-5-(trifluoromethyl)phenol |
| InChIKey | VNTKPYNBATZMSV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)F)C(F)(F)F |
Computed by PubChem (NCBI)