cas: 1380327-56-9 — see every product listed under this CAS number, including other names
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)oxetane-3-carboxylic acid, 98%, 98% (CAS 1380327-56-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AAXK-25mg |
| cas | 1380327-56-9 |
| size | 25mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 198.80 Pln | |
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 741.20 Pln | |
| Chemat | 500mg | 1269.20 Pln | |
| Chemat | 1g | 1326.80 Pln | |
| Chemat | 5g | 4485.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)oxetane-3-carboxylic acid (CAS 1380327-56-9) is a chemical compound with the molecular formula C19H17NO5 and a molecular weight of 339.3 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)oxetane-3-carboxylic acid. InChIKey: QUZXBKMAZQIBQR-UHFFFAOYSA-N.
| Molecular formula | C19H17NO5 |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)oxetane-3-carboxylic acid |
| InChIKey | QUZXBKMAZQIBQR-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)