CAS 1380327-56-9 appears in our catalog under these names: 3-Aminooxetane-3-carboxylic acid, n-fmoc protected, 95%, 3–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)oxetane–3–carboxylic acid, 3-Aminooxetane-3-carboxylic acid, N-FMOC protected, Fmoc-3-aminooxetane-3-carboxylic acid 98%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)oxetane-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg, 25mg, 500mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)oxetane-3-carboxylic acid (CAS 1380327-56-9) is a chemical compound with the molecular formula C19H17NO5 and a molecular weight of 339.3 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)oxetane-3-carboxylic acid. InChIKey: QUZXBKMAZQIBQR-UHFFFAOYSA-N.
| Molecular formula | C19H17NO5 |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)oxetane-3-carboxylic acid |
| InChIKey | QUZXBKMAZQIBQR-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)