cas: 799283-53-7 — see every product listed under this CAS number, including other names
3-((1-(Tert-butoxycarbonyl)piperidin-4-yl)methyl)benzoic acid, 97% (CAS 799283-53-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F729237-250MG |
| cas | 799283-53-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1695.25 Pln | |
| Fluorochem | 500mg | 2497.06 Pln | |
| Fluorochem | 1g | 3746.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]benzoic acid (CAS 799283-53-7) is a chemical compound with the molecular formula C18H25NO4 and a molecular weight of 319.4 g/mol. IUPAC name: 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]benzoic acid. InChIKey: HVECPVHFDIWDEL-UHFFFAOYSA-N.
| Molecular formula | C18H25NO4 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]benzoic acid |
| InChIKey | HVECPVHFDIWDEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)