CAS 959576-65-9 is the registry number for Boc-(phet)pro-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2-phenylethyl)pyrrolidine-2-carboxylic acid (CAS 959576-65-9) is a chemical compound with the molecular formula C18H25NO4 and a molecular weight of 319.4 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2-phenylethyl)pyrrolidine-2-carboxylic acid. InChIKey: URLLHYVBNNPLET-GOSISDBHSA-N.
| Molecular formula | C18H25NO4 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2-phenylethyl)pyrrolidine-2-carboxylic acid |
| InChIKey | URLLHYVBNNPLET-GOSISDBHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]1(CCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)