3-((1H-Indol-2-yl)methyl)-1H-indole, 95%
cas: 114648-66-7 — see every product listed under this CAS number, including other names
3-((1H-Indol-2-yl)methyl)-1H-indole, 95% (CAS 114648-66-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A735658-250mg |
| cas | 114648-66-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1644.19 Pln | |
| Ambeed | 1g | 4787.00 Pln | |
| Chemat | 100mg | 731.60 Pln | |
| Chemat | 250mg | 1403.60 Pln | |
| Chemat | 1g | 4077.20 Pln | |
| BLDpharm | 100mg | 847.50 Pln | |
| BLDpharm | 250mg | 1608.35 Pln | |
| BLDpharm | 1g | 4690.60 Pln | |
| Fluorochem | 100mg | 1351.62 Pln | |
| Fluorochem | 250mg | 2606.39 Pln | |
| Fluorochem | 1g | 7422.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(1H-indol-3-ylmethyl)-1H-indole (CAS 114648-66-7) is a chemical compound with the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. IUPAC name: 2-(1H-indol-3-ylmethyl)-1H-indole. InChIKey: SHXKYUYEFDONQC-UHFFFAOYSA-N.
| Molecular formula | C17H14N2 |
|---|---|
| Molecular weight | 246.31 g/mol |
| IUPAC name | 2-(1H-indol-3-ylmethyl)-1H-indole |
| InChIKey | SHXKYUYEFDONQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)CC3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)