CAS 50910-08-2 is the registry number for 2-N,N-Diphenylaminopyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
N,N-diphenylpyridin-2-amine (CAS 50910-08-2) is a chemical compound with the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. IUPAC name: N,N-diphenylpyridin-2-amine. InChIKey: YKNDJWVBAAZMDC-UHFFFAOYSA-N.
| Molecular formula | C17H14N2 |
|---|---|
| Molecular weight | 246.31 g/mol |
| IUPAC name | N,N-diphenylpyridin-2-amine |
| InChIKey | YKNDJWVBAAZMDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)