cas: 1153836-03-3 — see every product listed under this CAS number, including other names
3-((4-Fluorophenyl)sulfanyl)-2-methylpropanoic acid, 95% (CAS 1153836-03-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1012665-10g |
| cas | 1153836-03-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(4-fluorophenyl)sulfanyl-2-methylpropanoic acid (CAS 1153836-03-3) is a chemical compound with the molecular formula C10H11FO2S and a molecular weight of 214.26 g/mol. IUPAC name: 3-(4-fluorophenyl)sulfanyl-2-methylpropanoic acid. InChIKey: IVJVOKXHGHSVSE-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2S |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 3-(4-fluorophenyl)sulfanyl-2-methylpropanoic acid |
| InChIKey | IVJVOKXHGHSVSE-UHFFFAOYSA-N |
| SMILES | CC(CSC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)