CAS 2145093-90-7 appears in our catalog under these names: Methyl 3-fluoro-4-methyl-2-(methylsulfanyl)benzoate, 95%, Methyl 3-fluoro-4-methyl-2-(methylsulfanyl)benzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 3-fluoro-4-methyl-2-methylsulfanylbenzoate (CAS 2145093-90-7) is a chemical compound with the molecular formula C10H11FO2S and a molecular weight of 214.26 g/mol. IUPAC name: methyl 3-fluoro-4-methyl-2-methylsulfanylbenzoate. InChIKey: OGLCMYFSVWZGQK-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2S |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | methyl 3-fluoro-4-methyl-2-methylsulfanylbenzoate |
| InChIKey | OGLCMYFSVWZGQK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC)SC)F |
Computed by PubChem (NCBI)