cas: 5444-91-7 — see every product listed under this CAS number, including other names
3-((4-METHYLPIPERAZIN-1-YL)METHYL)-1H-INDOLE, 95% (CAS 5444-91-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F471230-250MG |
| cas | 5444-91-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1372.45 Pln | |
| Fluorochem | 5g | 5969.79 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-[(4-methylpiperazin-1-yl)methyl]-1H-indole (CAS 5444-91-7) is a chemical compound with the molecular formula C14H19N3 and a molecular weight of 229.32 g/mol. IUPAC name: 3-[(4-methylpiperazin-1-yl)methyl]-1H-indole. InChIKey: YLWXBMKGZWALKM-UHFFFAOYSA-N.
| Molecular formula | C14H19N3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | 3-[(4-methylpiperazin-1-yl)methyl]-1H-indole |
| InChIKey | YLWXBMKGZWALKM-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)