cas: 436095-35-1 — see every product listed under this CAS number, including other names
3-((4-Methylpiperazin-1-yl)sulfonyl)aniline, 95%, 95% (CAS 436095-35-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D09J-250mg |
| cas | 436095-35-1 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 1g | 938.00 Pln | |
| Chemat | 5g | 3414.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(4-methylpiperazin-1-yl)sulfonylaniline (CAS 436095-35-1) is a chemical compound with the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. IUPAC name: 3-(4-methylpiperazin-1-yl)sulfonylaniline. InChIKey: LENADRWBVLFBSX-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | 3-(4-methylpiperazin-1-yl)sulfonylaniline |
| InChIKey | LENADRWBVLFBSX-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)