CAS 1242282-03-6 is the registry number for 3-(3-Amino-4,5,6,7-tetrahydro-2H-indazol-2-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydroindazol-3-amine (CAS 1242282-03-6) is a chemical compound with the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. IUPAC name: 2-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydroindazol-3-amine. InChIKey: KBFLNPWQFJBKNI-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | 2-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydroindazol-3-amine |
| InChIKey | KBFLNPWQFJBKNI-UHFFFAOYSA-N |
| SMILES | C1CCC2=NN(C(=C2C1)N)C3CCS(=O)(=O)C3 |
Computed by PubChem (NCBI)