3-((Fluorosulfonyl)oxy)benzoic acid, 95%
cas: 1796596-42-3 — see every product listed under this CAS number, including other names
3-((Fluorosulfonyl)oxy)benzoic acid, 95% (CAS 1796596-42-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2719056-250mg |
| cas | 1796596-42-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1610.81 Pln | |
| Ambeed | 1g | 4720.25 Pln | |
| BLDpharm | 50mg | 564.27 Pln | |
| BLDpharm | 100mg | 891.93 Pln | |
| BLDpharm | 250mg | 1730.53 Pln | |
| BLDpharm | 1g | 5084.90 Pln | |
| Chemat | 100mg | 616.40 Pln | |
| Chemat | 250mg | 1182.80 Pln | |
| Chemat | 1g | 4499.60 Pln | |
| Chemat | 10g | 8987.60 Pln | |
| Chemat | 25g | 17776.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-fluorosulfonyloxybenzoic acid (CAS 1796596-42-3) is a chemical compound with the molecular formula C7H5FO5S and a molecular weight of 220.18 g/mol. IUPAC name: 3-fluorosulfonyloxybenzoic acid. InChIKey: GITIUVRLICWVQV-UHFFFAOYSA-N.
| Molecular formula | C7H5FO5S |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 3-fluorosulfonyloxybenzoic acid |
| InChIKey | GITIUVRLICWVQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OS(=O)(=O)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-[(fluorosulfonyl)oxy]benzoic acid
