CAS 881487-27-0 appears in our catalog under these names: 2-Fluoro-5-sulfo-benzoic Acid, 2-Fluoro-5-sulfo-benzoic acid, 95%+, 95%+, 2-FLUORO-5-SULFOBENZOIC ACID, 95%+. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g.
2-fluoro-5-sulfobenzoic acid (CAS 881487-27-0) is a chemical compound with the molecular formula C7H5FO5S and a molecular weight of 220.18 g/mol. IUPAC name: 2-fluoro-5-sulfobenzoic acid. InChIKey: DAYQUMDMVVFSIW-UHFFFAOYSA-N.
| Molecular formula | C7H5FO5S |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 2-fluoro-5-sulfobenzoic acid |
| InChIKey | DAYQUMDMVVFSIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)C(=O)O)F |
Computed by PubChem (NCBI)