cas: 110598-30-6 — see every product listed under this CAS number, including other names
3-((Trimethylsilyl)ethynyl)aniline 98% (CAS 110598-30-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A335779-1g |
| cas | 110598-30-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 1405.00 Pln | |
| Ambeed | 10g | 2461.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A335779 |
3-(2-trimethylsilylethynyl)aniline (CAS 110598-30-6) is a chemical compound with the molecular formula C11H15NSi and a molecular weight of 189.33 g/mol. IUPAC name: 3-(2-trimethylsilylethynyl)aniline. InChIKey: UMDLPUJBLHKTSG-UHFFFAOYSA-N.
| Molecular formula | C11H15NSi |
|---|---|
| Molecular weight | 189.33 g/mol |
| IUPAC name | 3-(2-trimethylsilylethynyl)aniline |
| InChIKey | UMDLPUJBLHKTSG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC(=CC=C1)N |
Computed by PubChem (NCBI)