cas: 372144-03-1 — see every product listed under this CAS number, including other names
3-((tert-Butoxycarbonyl)amino)-3-(piperidin-4-yl)propanoic acid 95% (CAS 372144-03-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A407429-50mg |
| cas | 372144-03-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 242.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A407429 |
3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-piperidin-4-ylpropanoic acid (CAS 372144-03-1) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-piperidin-4-ylpropanoic acid. InChIKey: RZBQGLZGJNCPPV-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-piperidin-4-ylpropanoic acid |
| InChIKey | RZBQGLZGJNCPPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1CCNCC1 |
Computed by PubChem (NCBI)