CAS 1219020-59-3 appears in our catalog under these names: Di-tert-butyl 1-cyclopropylhydrazine-1,2-dicarboxylate, 95%, Di–tert–butyl 1–cyclopropylhydrazine–1,2–dicarboxylate, Di-tert-butyl 1-cyclopropylhydrazine-1,2-dicarboxylate 97%, Di-Tert-Butyl 1-Cyclopropylhydrazine-1,2-Dicarboxylate, 97%, 97%, Di-tert-butyl 1-cyclopropylhydrazine-1,2-dicarboxylate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g, 100g, 500mg.
Tert-butyl N-cyclopropyl-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (CAS 1219020-59-3) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl N-cyclopropyl-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate. InChIKey: DDZCNVHWTVEKDS-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl N-cyclopropyl-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| InChIKey | DDZCNVHWTVEKDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NN(C1CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)