cas: 161006-18-4 — see every product listed under this CAS number, including other names
3-((tert-Butyldimethylsilyl)oxy)phenol 96% (CAS 161006-18-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A961908-250mg |
| cas | 161006-18-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1744.31 Pln | |
| Ambeed | 5g | 5098.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A961908 |
3-[tert-butyl(dimethyl)silyl]oxyphenol (CAS 161006-18-4) is a chemical compound with the molecular formula C12H20O2Si and a molecular weight of 224.37 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxyphenol. InChIKey: WNTUMICETVLAST-UHFFFAOYSA-N.
| Molecular formula | C12H20O2Si |
|---|---|
| Molecular weight | 224.37 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxyphenol |
| InChIKey | WNTUMICETVLAST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=CC(=C1)O |
Computed by PubChem (NCBI)