CAS 80180-46-7 appears in our catalog under these names: 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-phenol, 95%, 2-(((1,1-Dimethylethyl)dimethylsilyl)oxy)phenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
2-[tert-butyl(dimethyl)silyl]oxyphenol (CAS 80180-46-7) is a chemical compound with the molecular formula C12H20O2Si and a molecular weight of 224.37 g/mol. IUPAC name: 2-[tert-butyl(dimethyl)silyl]oxyphenol. InChIKey: LCTNVXUTAZVSEX-UHFFFAOYSA-N.
| Molecular formula | C12H20O2Si |
|---|---|
| Molecular weight | 224.37 g/mol |
| IUPAC name | 2-[tert-butyl(dimethyl)silyl]oxyphenol |
| InChIKey | LCTNVXUTAZVSEX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=CC=C1O |
Computed by PubChem (NCBI)