cas: 176504-36-2 — see every product listed under this CAS number, including other names
3-(1-(3-(Dimethylamino)Propyl)-1H-Indol-3-Yl)-4-(1H-Indol-3-Yl)-1H-Pyrrole-2,5-Dione Hydrochloride, 98% (CAS 176504-36-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch1135QJ-5mg |
| cas | 176504-36-2 |
| size | 5mg |
| availability | 0.25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 626.00 Pln | |
| Chemat | 10mg | 914.00 Pln | |
| Chemat | 25mg | 1677.20 Pln | |
| Chemat | 50mg | 2805.20 Pln | |
| BLDpharm | 5mg | 642.02 Pln | |
| BLDpharm | 10mg | 930.81 Pln | |
| BLDpharm | 25mg | 1702.76 Pln | |
| BLDpharm | 50mg | 2846.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione;hydrochloride (CAS 176504-36-2) is a chemical compound with the molecular formula C25H25ClN4O2 and a molecular weight of 448.9 g/mol. IUPAC name: 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione;hydrochloride. InChIKey: XRAMWNCMYJHGGH-UHFFFAOYSA-N.
| Molecular formula | C25H25ClN4O2 |
|---|---|
| Molecular weight | 448.9 g/mol |
| IUPAC name | 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione;hydrochloride |
| InChIKey | XRAMWNCMYJHGGH-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CNC5=CC=CC=C54.Cl |
Computed by PubChem (NCBI)