Products 1111233-06-7
CAS 1111233-06-7 is the registry number for CP-17. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-[(5-chloro-2-methylphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide (CAS 1111233-06-7) is a chemical compound with the molecular formula C25H25ClN4O2 and a molecular weight of 448.9 g/mol. IUPAC name: N-[3-[(5-chloro-2-methylphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide. InChIKey: JOZBIBZIRIKWFL-UHFFFAOYSA-N.
| Molecular formula | C25H25ClN4O2 |
|---|---|
| Molecular weight | 448.9 g/mol |
| IUPAC name | N-[3-[(5-chloro-2-methylphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide |
| InChIKey | JOZBIBZIRIKWFL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)NC(=O)NC2=C(C=CC(=C2)NC(=O)C3=CC=CC=C3)N4CCCC4 |
Computed by PubChem (NCBI)