cas: 625386-57-4 — see every product listed under this CAS number, including other names
3-(1-Piperazinylmethyl)-1H-pyrrolo[2,3-b]pyridine, 97%, 97% (CAS 625386-57-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJTX-1g |
| cas | 625386-57-4 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 842.00 Pln | |
| Chemat | 5g | 2987.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(piperazin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 625386-57-4) is a chemical compound with the molecular formula C12H16N4 and a molecular weight of 216.28 g/mol. IUPAC name: 3-(piperazin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: MCGNRNJEWMZYON-UHFFFAOYSA-N.
| Molecular formula | C12H16N4 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 3-(piperazin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | MCGNRNJEWMZYON-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CNC3=C2C=CC=N3 |
Computed by PubChem (NCBI)