CAS 1363648-61-6 is the registry number for rel-6-((3S,5R)-3,5-Dimethylpiperazin-1-yl)nicotinonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyridine-3-carbonitrile (CAS 1363648-61-6) is a chemical compound with the molecular formula C12H16N4 and a molecular weight of 216.28 g/mol. IUPAC name: 6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyridine-3-carbonitrile. InChIKey: CRKFJAWCKFZUNQ-AOOOYVTPSA-N.
| Molecular formula | C12H16N4 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyridine-3-carbonitrile |
| InChIKey | CRKFJAWCKFZUNQ-AOOOYVTPSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C2=NC=C(C=C2)C#N |
Computed by PubChem (NCBI)