cas: 474707-70-5 — see every product listed under this CAS number, including other names
3-(2,4-Difluorophenyl)-1H-pyrazole, 97% (CAS 474707-70-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A323134-250mg |
| cas | 474707-70-5 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 369.46 Pln | |
| AmBeed | 25g | 8363.74 Pln | |
| Fluorochem | 1g | 737.26 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(2,4-difluorophenyl)-1H-pyrazole (CAS 474707-70-5) is a chemical compound with the molecular formula C9H6F2N2 and a molecular weight of 180.15 g/mol. IUPAC name: 5-(2,4-difluorophenyl)-1H-pyrazole. InChIKey: BQADOWRGYCGUND-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2 |
|---|---|
| Molecular weight | 180.15 g/mol |
| IUPAC name | 5-(2,4-difluorophenyl)-1H-pyrazole |
| InChIKey | BQADOWRGYCGUND-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=CC=NN2 |
Computed by PubChem (NCBI)