CAS 1189107-49-0 appears in our catalog under these names: 4-Amino-7,8-difluoroquinoline, 95%, 7,8-Difluoroquinolin-4-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
7,8-difluoroquinolin-4-amine (CAS 1189107-49-0) is a chemical compound with the molecular formula C9H6F2N2 and a molecular weight of 180.15 g/mol. IUPAC name: 7,8-difluoroquinolin-4-amine. InChIKey: ANZXGIJRDZNLHQ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2 |
|---|---|
| Molecular weight | 180.15 g/mol |
| IUPAC name | 7,8-difluoroquinolin-4-amine |
| InChIKey | ANZXGIJRDZNLHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=CC(=C21)N)F)F |
Computed by PubChem (NCBI)