cas: 129967-42-6 — see every product listed under this CAS number, including other names
3-(2-Hydroxy-4,6-dimethylphenyl)-3,3-dimethylpropan-1-ol 95% (CAS 129967-42-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A984651-250mg |
| cas | 129967-42-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2478.56 Pln | |
| Ambeed | 1g | 6094.19 Pln | |
| Ambeed | 5g | 25535.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A984651 |
2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenol (CAS 129967-42-6) is a chemical compound with the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. IUPAC name: 2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenol. InChIKey: ZVXWXORBQGXYPQ-UHFFFAOYSA-N.
| Molecular formula | C13H20O2 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenol |
| InChIKey | ZVXWXORBQGXYPQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)O)C(C)(C)CCO)C |
Computed by PubChem (NCBI)