CAS 129967-42-6 appears in our catalog under these names: 2-(4-Hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenol, 95%, 3-(2-Hydroxy-4,6-dimethylphenyl)-3,3-dimethylpropan-1-ol 95%, 3-(2-Hydroxy-4,6-dimethylphenyl)-3,3-dimethylpropan-1-ol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenol (CAS 129967-42-6) is a chemical compound with the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. IUPAC name: 2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenol. InChIKey: ZVXWXORBQGXYPQ-UHFFFAOYSA-N.
| Molecular formula | C13H20O2 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenol |
| InChIKey | ZVXWXORBQGXYPQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)O)C(C)(C)CCO)C |
Computed by PubChem (NCBI)