cas: 924868-82-6 — see every product listed under this CAS number, including other names
3-(3,5-Dimethoxyphenyl)-1,2-oxazol-5-amine, 97% (CAS 924868-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F666848-100MG |
| cas | 924868-82-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 500mg | 726.85 Pln | |
| Fluorochem | 1g | 914.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(3,5-dimethoxyphenyl)-1,2-oxazol-5-amine (CAS 924868-82-6) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 3-(3,5-dimethoxyphenyl)-1,2-oxazol-5-amine. InChIKey: BDIHALGDOAGACB-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 3-(3,5-dimethoxyphenyl)-1,2-oxazol-5-amine |
| InChIKey | BDIHALGDOAGACB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=NOC(=C2)N)OC |
Computed by PubChem (NCBI)