Products 957042-21-6
CAS 957042-21-6 is the registry number for 5-(3-Methoxyphenyl)-5-methylimidazolidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione (CAS 957042-21-6) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione. InChIKey: NNVHPONDRXEYJH-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | NNVHPONDRXEYJH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)