3-(3-(Dimethylamino)propyl)-4-hydroxy-N-(4-(pyridin-4-yl)phenyl)benzamide dihydrochloride, 98+%
cas: 159533-25-2 — see every product listed under this CAS number, including other names
3-(3-(Dimethylamino)propyl)-4-hydroxy-N-(4-(pyridin-4-yl)phenyl)benzamide dihydrochloride, 98+% (CAS 159533-25-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch12ENRL-10mg |
| cas | 159533-25-2 |
| size | 10mg |
| availability | 1.25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 621.20 Pln | |
| Chemat | 25mg | 1120.40 Pln | |
| Chemat | 50mg | 1859.60 Pln | |
| Chemat | 100mg | 3112.40 Pln | |
| Chemat | 250mg | 5858.00 Pln | |
| BLDpharm | 10mg | 636.47 Pln | |
| BLDpharm | 25mg | 1141.84 Pln | |
| BLDpharm | 50mg | 1891.58 Pln | |
| BLDpharm | 100mg | 3157.80 Pln | |
| BLDpharm | 250mg | 5934.60 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
3-[3-(dimethylamino)propyl]-4-hydroxy-N-(4-pyridin-4-ylphenyl)benzamide;dihydrochloride (CAS 159533-25-2) is a chemical compound with the molecular formula C23H27Cl2N3O2 and a molecular weight of 448.4 g/mol. IUPAC name: 3-[3-(dimethylamino)propyl]-4-hydroxy-N-(4-pyridin-4-ylphenyl)benzamide;dihydrochloride. InChIKey: KBKWJHYQFQONBJ-UHFFFAOYSA-N.
| Molecular formula | C23H27Cl2N3O2 |
|---|---|
| Molecular weight | 448.4 g/mol |
| IUPAC name | 3-[3-(dimethylamino)propyl]-4-hydroxy-N-(4-pyridin-4-ylphenyl)benzamide;dihydrochloride |
| InChIKey | KBKWJHYQFQONBJ-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1=C(C=CC(=C1)C(=O)NC2=CC=C(C=C2)C3=CC=NC=C3)O.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
orb1704508