Products 159533-25-2
CAS 159533-25-2 appears in our catalog under these names: GR 55562 Dihydrochloride, GR 55562 dihydrochloride, GR 55562 2HCl 98+%, 3-(3-(Dimethylamino)propyl)-4-hydroxy-N-(4-(pyridin-4-yl)phenyl)benzamide dihydrochloride, 98+%, 98+%, GR 55562 (dihydrochloride), 99.0%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 75mg, 10mg, 50mg, 100mg, 25mg, 250mg, 10 mg, 5 mg.
3-[3-(dimethylamino)propyl]-4-hydroxy-N-(4-pyridin-4-ylphenyl)benzamide;dihydrochloride (CAS 159533-25-2) is a chemical compound with the molecular formula C23H27Cl2N3O2 and a molecular weight of 448.4 g/mol. IUPAC name: 3-[3-(dimethylamino)propyl]-4-hydroxy-N-(4-pyridin-4-ylphenyl)benzamide;dihydrochloride. InChIKey: KBKWJHYQFQONBJ-UHFFFAOYSA-N.
| Molecular formula | C23H27Cl2N3O2 |
|---|---|
| Molecular weight | 448.4 g/mol |
| IUPAC name | 3-[3-(dimethylamino)propyl]-4-hydroxy-N-(4-pyridin-4-ylphenyl)benzamide;dihydrochloride |
| InChIKey | KBKWJHYQFQONBJ-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1=C(C=CC(=C1)C(=O)NC2=CC=C(C=C2)C3=CC=NC=C3)O.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
orb1704508