cas: 7256-95-3 — see every product listed under this CAS number, including other names
3-(3-Aminopropyl)-5-(1h-indol-3-yl)pyrazin-2-amine, 95% (CAS 7256-95-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F719258-100MG |
| cas | 7256-95-3 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1648.40 Pln | |
| Fluorochem | 250mg | 2569.95 Pln | |
| Fluorochem | 500mg | 4183.96 Pln | |
| Fluorochem | 1g | 6245.74 Pln | |
| Fluorochem | 5g | 18205.07 Pln | |
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1288.40 Pln | |
| Chemat | 500mg | 2104.40 Pln | |
| Chemat | 1g | 3126.80 Pln | |
| Chemat | 5g | 9251.60 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3-(3-aminopropyl)-5-(1H-indol-3-yl)pyrazin-2-amine (CAS 7256-95-3) is a chemical compound with the molecular formula C15H17N5 and a molecular weight of 267.33 g/mol. IUPAC name: 3-(3-aminopropyl)-5-(1H-indol-3-yl)pyrazin-2-amine. InChIKey: VTQXQNOJAUQUCO-UHFFFAOYSA-N.
| Molecular formula | C15H17N5 |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | 3-(3-aminopropyl)-5-(1H-indol-3-yl)pyrazin-2-amine |
| InChIKey | VTQXQNOJAUQUCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=CN=C(C(=N3)CCCN)N |
Computed by PubChem (NCBI)