cas: 381214-37-5 — see every product listed under this CAS number, including other names
3-(3-Methoxyphenyl)-1-phenyl-1H-pyrazole-4-carboxylic acid, 95% (CAS 381214-37-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F641542-100MG |
| cas | 381214-37-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 674.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxylic acid (CAS 381214-37-5) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: 3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: YUDUFBFUQOJLGG-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | YUDUFBFUQOJLGG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NN(C=C2C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)