cas: 1112209-48-9 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzaldehyde, 98% (CAS 1112209-48-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691531-250MG |
| cas | 1112209-48-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1320.39 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzaldehyde (CAS 1112209-48-9) is a chemical compound with the molecular formula C14H16BF3O4 and a molecular weight of 316.08 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzaldehyde. InChIKey: GFHMALKDEOCONV-UHFFFAOYSA-N.
| Molecular formula | C14H16BF3O4 |
|---|---|
| Molecular weight | 316.08 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | GFHMALKDEOCONV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC(F)(F)F)C=O |
Computed by PubChem (NCBI)