cas: 443776-76-9 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl Alcohol, >98.0%(GC)(T) (CAS 443776-76-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3830-1G |
| cas | 443776-76-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 98.68 Pln | |
| TCI | 5g | 256.03 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 443776-76-9) is a chemical compound with the molecular formula C13H19BO3 and a molecular weight of 234.10 g/mol. IUPAC name: [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: ZEWWJJQAFTXUIS-UHFFFAOYSA-N.
| Molecular formula | C13H19BO3 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | ZEWWJJQAFTXUIS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CO |
Computed by PubChem (NCBI)