cas: 878194-91-3 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isonicotinonitrile, 95% (CAS 878194-91-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217859-100MG |
| cas | 878194-91-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 5g | 2658.46 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carbonitrile (CAS 878194-91-3) is a chemical compound with the molecular formula C12H15BN2O2 and a molecular weight of 230.07 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carbonitrile. InChIKey: DQQFRFWEPQBNEN-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O2 |
|---|---|
| Molecular weight | 230.07 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carbonitrile |
| InChIKey | DQQFRFWEPQBNEN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2)C#N |
Computed by PubChem (NCBI)