Products 1822374-04-8
CAS 1822374-04-8 is the registry number for 4-Ethynyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethynyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1822374-04-8) is a chemical compound with the molecular formula C12H15BN2O2 and a molecular weight of 230.07 g/mol. IUPAC name: 4-ethynyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: MHJJVAMMQZHHDX-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O2 |
|---|---|
| Molecular weight | 230.07 g/mol |
| IUPAC name | 4-ethynyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | MHJJVAMMQZHHDX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CN=C2C#C |
Computed by PubChem (NCBI)