cas: 845873-35-0 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde 98% (CAS 845873-35-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1160208-100mg |
| cas | 845873-35-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1555.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1160208 |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde (CAS 845873-35-0) is a chemical compound with the molecular formula C11H15BO3S and a molecular weight of 238.12 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde. InChIKey: BRXYKYHKDVEBKJ-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3S |
|---|---|
| Molecular weight | 238.12 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde |
| InChIKey | BRXYKYHKDVEBKJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)C=O |
Computed by PubChem (NCBI)